
من موسوعة العلوم العربية
مراجعة 13:58، 27 مايو 2013 بواسطة كنان الطرح (نقاش | مساهمات)
(فرق) → مراجعة أقدم | المراجعة الحالية (فرق) | مراجعة أحدث ← (فرق)
اذهب إلى التنقل اذهب إلى البحث
دانا حمد
المساهمة الرئيسية في هذا المقال

{{Drugbox | English = Rescinnamine | verifiedrevid = 464380960 | IUPAC_name = methyl (3β,16β,17α,18β,20α)-11,17-dimethoxy-18-{[(2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy}yohimban-16-carboxylate | image = Rescinnamine.svg | width = 300

| tradename = | pregnancy_category = | legal_status = Rx-only | routes_of_administration = oral

| bioavailability = | protein_bound = | metabolism = | elimination_half-life =

| CASNo_Ref =  YesY | CAS_number_Ref =  YesY | CAS_number = 24815-24-5 | ATC_prefix = C02 | ATC_suffix = AA01 | ATC_supplemental = | PubChem = 5280954 | DrugBank_Ref =  قالب:علامة اختيار

| DrugBank = DB01180

| ChemSpiderID_Ref =  YesY | ChemSpiderID = 4444446 | UNII_Ref =  YesY | UNII = Q6W1F7DJ2D | KEGG_Ref =  YesY | KEGG = D00198 | ChEBI_Ref =  YesY | ChEBI = 28572 | ChEMBL_Ref =  YesY | ChEMBL = 1668

| C=35 | H=42 | N=2 | O=9 | molecular_weight = 634.716 g/mol | smiles = O=C(OC)[C@H]6[C@H]4C[C@@H]3c2nc1cc(OC)ccc1c2CCN3C[C@H]4C[C@@H](OC(=O)\C=C\c5cc(OC)c(OC)c(OC)c5)[C@@H]6OC | InChI = 1/C35H42N2O9/c1-40-21-8-9-22-23-11-12-37-18-20-15-29(46-30(38)10-7-19-13-27(41-2)33(43-4)28(14-19)42-3)34(44-5)31(35(39)45-6)24(20)17-26(37)32(23)36-25(22)16-21/h7-10,13-14,16,20,24,26,29,31,34,36H,11-12,15,17-18H2,1-6H3/b10-7+/t20-,24+,26-,29-,31+,34+/m1/s1 | InChIKey = SZLZWPPUNLXJEA-QEGASFHIBN | StdInChI_Ref =  YesY | StdInChI = 1S/C35H42N2O9/c1-40-21-8-9-22-23-11-12-37-18-20-15-29(46-30(38)10-7-19-13-27(41-2)33(43-4)28(14-19)42-3)34(44-5)31(35(39)45-6)24(20)17-26(37)32(23)36-25(22)16-21/h7-10,13-14,16,20,24,26,29,31,34,36H,11-12,15,17-18H2,1-6H3/b10-7+/t20-,24+,26-,29-,31+,34+/m1/s1 | StdInChIKey_Ref =  YesY | StdInChIKey = SZLZWPPUNLXJEA-QEGASFHISA-N | synonyms = methyl (1R,15S,17R,18R,19S,20S)-6,18-dimethoxy-17-{[(2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy}-3,13-diazapentacyclo[,10.04,9.015,20]henicosa-2(10),4(9),5,7-tetraene-19-carboxylate }}

ريسينامين rescinnamine وهو مثبط للأنزيم المحول للأنجيوتنسين ويستخدم كدواء خافض لضغط الدم. وهو عبارة عن قلويد يستحصل عليه من الراولفيا الثعبانية Rauwolvia serpentine و غيرها من أنواع الراولفيا.