الفرق بين المراجعتين ل"روزوفاستاتين"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
سطر 1: سطر 1:
[[ملف:Rosuvastatin.png |thumb|250px]]
| English = Rosuvastatin
| Verifiedfields = changed
| verifiedrevid = 464383832
| IUPAC_name = (3''R'',5''S'',6''E'')-7-[4-(4-fluorophenyl)-2-(''N''-methylmethanesulfonamido)-6-(propan-2-yl)pyrimidin-5-yl]-3,5-dihydroxyhept-6-enoic acid
| image = Rosuvastatin-Formulae V 1.png
| width = 250
| image2 = Rosuvastatin3Dan.gif
| width2 = 250
<!--Clinical data-->
| tradename = Crestor
| Drugs.com = {{drugs.com|monograph|crestor}}
| MedlinePlus = a603033
| pregnancy_AU = D
| pregnancy_US = X
| pregnancy_category = 
| legal_AU = S4
| legal_UK = POM
| legal_US = Rx-only
| legal_status = 
| routes_of_administration = oral
<!--Pharmacokinetic data-->
| bioavailability = 20%
| metabolism = [[Liver]]
| elimination_half-life = 19 h
| excretion = Urine / Faeces
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 287714-41-4
| ATC_prefix = C10
| ATC_suffix = AA07
| PubChem = 446157
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01098
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 393589
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 413KH5ZJ73
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D01915
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 38545
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1496
<!--Chemical data-->
| C=22 | H=28 | F=1 | N=3 | O=6 | S=1
| molecular_weight = 481.539
| smiles = O=S(=O)(N(c1nc(c(c(n1)C(C)C)/C=C/[C@@H](O)C[C@@H](O)CC(=O)O)c2ccc(F)cc2)C)C
| InChI = 1/C22H28FN3O6S/c1-13(2)20-18(10-9-16(27)11-17(28)12-19(29)30)21(14-5-7-15(23)8-6-14)25-22(24-20)26(3)33(4,31)32/h5-10,13,16-17,27-28H,11-12H2,1-4H3,(H,29,30)/b10-9+/t16-,17-/m1/s1
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C22H28FN3O6S/c1-13(2)20-18(10-9-16(27)11-17(28)12-19(29)30)21(14-5-7-15(23)8-6-14)25-22(24-20)26(3)33(4,31)32/h5-10,13,16-17,27-28H,11-12H2,1-4H3,(H,29,30)/b10-9+/t16-,17-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
'''روزوفاستاتين (Rosuvastatin)'''
'''روزوفاستاتين (Rosuvastatin)'''
==الزمرة الدوائية==
==الزمرة الدوائية==
[[خافض شحوم]]
[[خافضات شحوم الدم]]
==الصيغة الكيميائية==
سطر 16: سطر 72:
روزوفاستاتين مثبط تنافسي لانزيم HMG-CoA reductase) 3-hydroxy-3-methyl-glutaryl-CoA reductase)، إن أنزيم  HMG-CoA reductase يتوسط تحول HMG-CoA إلى ميفالونات، وهي مرحلة سابقة لاصطناع الكوليسترول. يعمل الروزوفاستاتين على خفض تراكيز الكوليسترل في الكبد عن طريق تحفيز اصطناع مستقبلات الليبوبروتين منخفض الكثافة [[(LDL)]] مما يزيد من القبط الكبدي للـ [[(LDL)]]. أيضاً يثبط الروزوفاستاتين الاصطناع الكبدي للـ [[(vLDL)]]. والمحصلة تكون انخفاض في التراكيز المصلية لكل من [[(vLDL)]] و [[(LDL)]].
روزوفاستاتين مثبط تنافسي لانزيم HMG-CoA reductase) 3-hydroxy-3-methyl-glutaryl-CoA reductase)، إن أنزيم  HMG-CoA reductase يتوسط تحول HMG-CoA إلى ميفالونات، وهي مرحلة سابقة لاصطناع الكوليسترول. يعمل الروزوفاستاتين على خفض تراكيز الكوليسترل في الكبد عن طريق تحفيز اصطناع مستقبلات الليبوبروتين منخفض الكثافة [[(LDL)]] مما يزيد من القبط الكبدي للـ [[(LDL)]]. أيضاً يثبط الروزوفاستاتين الاصطناع الكبدي للـ [[(vLDL)]]. والمحصلة تكون انخفاض في التراكيز المصلية لكل من [[(vLDL)]] و [[(LDL)]].
==الحرائك الدوائية==
التوافر الحيوي 20%
===التوافر الحيوي===
==نصف العمر==  
===نصف العمر===  
16 ساعة
16 ساعة

مراجعة 16:56، 11 أغسطس 2013

Systematic (IUPAC) name
(3R,5S,6E)-7-[4-(4-fluorophenyl)-2-(N-methylmethanesulfonamido)-6-(propan-2-yl)pyrimidin-5-yl]-3,5-dihydroxyhept-6-enoic acid
Clinical data
Trade names Crestor
AHFS/Drugs.com monograph
MedlinePlus a603033
Pregnancy cat. D (AU) X (US)
Legal status Prescription Only (S4) (AU) POM (UK) -only (US)
Routes oral
Pharmacokinetic data
Bioavailability 20%
Metabolism Liver
Half-life 19 h
Excretion Urine / Faeces
CAS number 287714-41-4 YesY
ATC code C10AA07
PubChem CID 446157
DrugBank DB01098
ChemSpider 393589 N
UNII 413KH5ZJ73 YesY
KEGG D01915 N
Chemical data
Formula C22H28FN3O6S 
Mol. mass 481.539
 N (what is this?)  (verify)

روزوفاستاتين (Rosuvastatin)

الزمرة الدوائية

خافضات شحوم الدم


يستخدم بالمساعدة مع المعالجة الغذائية لعلاج ارتفاع الكوليسترول الأولي.

الحرائك الدوائية

روزوفاستاتين مركب صنعي يستخدم لخفض التركيز البلازمي لكل من الكوليسترول الكلي، الليبوبروتين منخفض الكثافة (LDL)، أبوليبوبروتين (apoB)، والتري غليسريد (TG)، بينما يزيد من تراكيز الليبوبروتين مرتفع الكثافة (HDL).

آلية التأثير

روزوفاستاتين مثبط تنافسي لانزيم HMG-CoA reductase) 3-hydroxy-3-methyl-glutaryl-CoA reductase)، إن أنزيم HMG-CoA reductase يتوسط تحول HMG-CoA إلى ميفالونات، وهي مرحلة سابقة لاصطناع الكوليسترول. يعمل الروزوفاستاتين على خفض تراكيز الكوليسترل في الكبد عن طريق تحفيز اصطناع مستقبلات الليبوبروتين منخفض الكثافة (LDL) مما يزيد من القبط الكبدي للـ (LDL). أيضاً يثبط الروزوفاستاتين الاصطناع الكبدي للـ (vLDL). والمحصلة تكون انخفاض في التراكيز المصلية لكل من (vLDL) و (LDL).

الحرائك الدوائية

التوافر الحيوي


نصف العمر

16 ساعة

التأثيرات الجانبية

  • ألم عضلي
  • إمساك
  • ضعف
  • ألم بطني
  • غثيان
  • سمية عضلية
  • سمية كبدية

التداخلات الدوائية

