الفرق بين المراجعتين ل"أرباكلوفن بلاكاربيل"

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
[مراجعة منقحة][مراجعة منقحة]
(أنشأ الصفحة ب''''أرباكلوفن بلاكاربيل''' ( المعروف أيضاً بـ XP19986 ) هو طليعة دواء غير مألوفة لـ باكلوفن المُيم...')
 
سطر 1: سطر 1:
 +
{{Drugbox
 +
| English = Arbaclofen placarbil
 +
| verifiedrevid =
 +
| IUPAC_name = (3''R'')-3-(4-chlorophenyl)-4-[​[​[(1''S'')-2-methyl-1-[(2-methylpropanoyl)oxy]propoxy]carbonyl]amino]butanoic acid
 +
| image = Arbaclofen placarbil.svg
 +
| width = 260
 +
 +
<!--Clinical data-->
 +
| tradename = 
 +
| Drugs.com =
 +
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
 +
| pregnancy_US = <!-- A / B / C / D / X -->
 +
| pregnancy_category =
 +
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 -->
 +
| legal_UK = <!-- GSL / P / POM / CD -->
 +
| legal_US = <!-- OTC / Rx-only -->
 +
| legal_status =
 +
| routes_of_administration = 
 +
 +
<!--Pharmacokinetic data-->
 +
| bioavailability =
 +
| protein_bound =
 +
| metabolism =
 +
| elimination_half-life =
 +
| excretion =
 +
 +
<!--Identifiers-->
 +
| CASNo_Ref = {{cascite|correct|CAS}}
 +
| CAS_number = 847353-30-4
 +
| ATC_prefix =
 +
| ATC_suffix =
 +
| ATC_supplemental = 
 +
| PubChem = 96025544
 +
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
 +
| DrugBank =
 +
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 +
| ChemSpiderID =
 +
| UNII_Ref = {{fdacite|correct|FDA}}
 +
| UNII =
 +
| KEGG_Ref = {{keggcite|correct|kegg}}
 +
| KEGG = D08861
 +
| ChEMBL_Ref = {{ebicite|correct|EBI}}
 +
| ChEMBL =
 +
 +
<!--Chemical data-->
 +
| C=19 | H=26 | Cl=1 | N=1 | O=6
 +
| molecular_weight = 399.86 g/mol
 +
| smiles = C1C=C(C=CC=1[C@H](CNC(=O)O[C@H](OC(=O)C(C)C)C(C)C)CC(O)=O)Cl
 +
| InChI=1S/C19H26ClNO6/c1-11(2)17(24)26-18(12(3)4)27-19(25)21-10-14(9-16(22)23)13-5-7-15(20)8-6-13/h5-8,11-12,14,18H,9-10H2,1-4H3,(H,21,25)(H,22,23)/t14-,18?/m1/s1
 +
| InChIKey =
 +
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
 +
| StdInChI =
 +
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 +
| StdInChIKey =
 +
}}
 
'''أرباكلوفن بلاكاربيل''' ( المعروف أيضاً بـ XP19986 ) هو طليعة دواء غير مألوفة لـ [[باكلوفن]] المُيمّن R-baclofen. يمتلك أرباكلوفن بلاكاربيل ملف حركية دوائية ملائم أكثر من ال[[باكلوفن]] ، مع تأرجحات أقل في مستويات الدواء في البلازما. تم تطويره كعلاج محتمل لمرضى [[قلس مريئي|القلس المعدي المريئي]] و فرط التوتر التشنجي المُسبب ب[[تصلب لويحي|التصلب اللويحي]] ، على كل حال، في شهر أيار عام 2013 فإن شركة XenoPort أعلنت عن إنتهاء التطوير بسبب النتائج غير الناجحة في الطور الثالث من التجارب السريرية.
 
'''أرباكلوفن بلاكاربيل''' ( المعروف أيضاً بـ XP19986 ) هو طليعة دواء غير مألوفة لـ [[باكلوفن]] المُيمّن R-baclofen. يمتلك أرباكلوفن بلاكاربيل ملف حركية دوائية ملائم أكثر من ال[[باكلوفن]] ، مع تأرجحات أقل في مستويات الدواء في البلازما. تم تطويره كعلاج محتمل لمرضى [[قلس مريئي|القلس المعدي المريئي]] و فرط التوتر التشنجي المُسبب ب[[تصلب لويحي|التصلب اللويحي]] ، على كل حال، في شهر أيار عام 2013 فإن شركة XenoPort أعلنت عن إنتهاء التطوير بسبب النتائج غير الناجحة في الطور الثالث من التجارب السريرية.
 
==المصدر:==
 
==المصدر:==
http://en.wikipedia.org/wiki/Arbaclofen_placarbil
+
https://en.wikipedia.org/wiki/Arbaclofen_placarbil
  
 
{{أدوية القرحة والقلس المريئي}}
 
{{أدوية القرحة والقلس المريئي}}

مراجعة 16:30، 17 أكتوبر 2013

أرباكلوفن بلاكاربيل
Systematic (IUPAC) name
(3R)-3-(4-chlorophenyl)-4-[​[​[(1S)-2-methyl-1-[(2-methylpropanoyl)oxy]propoxy]carbonyl]amino]butanoic acid
Clinical data
Pregnancy cat. ?
Legal status ?
Identifiers
CAS number 847353-30-4
ATC code ?
PubChem CID 96025544
KEGG D08861 YesY
Chemical data
Formula C19H26ClNO6 
Mol. mass 399.86 g/mol

أرباكلوفن بلاكاربيل ( المعروف أيضاً بـ XP19986 ) هو طليعة دواء غير مألوفة لـ باكلوفن المُيمّن R-baclofen. يمتلك أرباكلوفن بلاكاربيل ملف حركية دوائية ملائم أكثر من الباكلوفن ، مع تأرجحات أقل في مستويات الدواء في البلازما. تم تطويره كعلاج محتمل لمرضى القلس المعدي المريئي و فرط التوتر التشنجي المُسبب بالتصلب اللويحي ، على كل حال، في شهر أيار عام 2013 فإن شركة XenoPort أعلنت عن إنتهاء التطوير بسبب النتائج غير الناجحة في الطور الثالث من التجارب السريرية.

المصدر:

https://en.wikipedia.org/wiki/Arbaclofen_placarbil