أسيل سيوف: أنشأ الصفحة ب'{{Drugbox | IUPAC_name = diethyl [4-(1,3-benzothiazol-2-yl)benzyl]phosphonate | image = Fostedil_structure.png | tradename = | pregnancy_category...'

2013-06-01T19:51:05Z

أنشأ الصفحة ب'{{Drugbox | IUPAC_name = diethyl [4-(1,3-benzothiazol-2-yl)benzyl]phosphonate | image = Fostedil_structure.png  | tradename = | pregnancy_category...'

صفحة جديدة

{{Drugbox
| IUPAC_name = diethyl [4-(1,3-benzothiazol-2-yl)benzyl]phosphonate
| image = Fostedil_structure.png


| tradename =
| pregnancy_category =
| legal_status = Uncontrolled
| routes_of_administration = Oral


| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =


| CAS_number = 75889-62-2
| ATC_prefix = none
| ATC_suffix =
| PubChem = 53421
| ChemSpiderID = 48253
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = D41WS786UL
| KEGG = D04260
| ChEMBL = 39516


| C=18 | N=1 | O=3 | P=1 | S=1
| molecular_weight = 361.40 g/mol
| smiles = O=P(OCC)(OCC)Cc3ccc(c1nc2ccccc2s1)cc3
}}

'''فوستيديل Fostedil''' هو موسع وعائي يعمل كحاصر لقنوات الكالسيوم، وكان في طور التطوير لعلاج حالات القلب (كالذبحة الصدرية) ولكنه لم يسوق.<ref name="isbn0-412-46630-9">{{cite book | author = David J. Triggle | title = Dictionary of Pharmacological Agents | publisher = Chapman & Hall/CRC | location = Boca Raton | year = 1996 | pages = | isbn = 0-412-46630-9 | oclc = | doi = | url = http://books.google.com/?id=DeX7jgInYFMC&lpg=PA931&dq=Fostedil&pg=PA931#v=onepage&q}}</ref><ref name="pmid3902675">{{cite journal | author = Khurmi NS, Bowles MJ, O'Hara MJ, Lahiri A, Raftery EB | title = Ambulatory monitoring and exercise testing in the evaluation of a new long-acting calcium ion antagonist KB-944 (Fostedil) for the treatment of exertional angina pectoris | journal = International Journal of Cardiology | volume = 9 | issue = 3 | pages = 289–302 | year = 1985 | month = November | pmid = 3902675 | doi = 10.1016/0167-5273(85)90027-0| url = }}</ref><ref name="pmid6890822">{{cite journal | author = Morita T, Yoshino K, Kanazawa T, Ito K, Nose T | title = Vasodilator action of KB-944, a new calcium antagonist | journal = Arzneimittel-Forschung | volume = 32 | issue = 9 | pages = 1037–42 | year = 1982 | pmid = 6890822 | doi = | url = }}</ref><ref name="pmid6890823">{{cite journal | author = Morita T, Kanazawa T, Ito K, Nose T | title = Vasodilator mechanism of KB-944, a new calcium antagonist | journal = Arzneimittel-Forschung | volume = 32 | issue = 9 | pages = 1043–6 | year = 1982 | pmid = 6890823 | doi = | url = }}</ref>
له تأثير [[خافض للضغط]] و[[مضاد للروماتيزم]].<ref name="pmid6890824">{{cite journal | author = Morita T, Kanazawa T, Ito K, Nose T | title = Antihypertensive effect of KB-944, a new calcium antagonist, in conscious normotensive and hypertensive rats | journal = Arzneimittel-Forschung | volume = 32 | issue = 9 | pages = 1047–52 | year = 1982 | pmid = 6890824 | doi = | url = }}</ref><ref name="pmid6890825">{{cite journal | author = Morita T, Ito K, Nose T | title = Cardiac action of KB-944, a new calcium antagonist | journal = Arzneimittel-Forschung | volume = 32 | issue = 9 | pages = 1053–5 | year = 1982 | pmid = 6890825 | doi = | url = }}</ref><ref name="pmid6890826">{{cite journal | author = Yoshidomi M, Sukamoto T, Morita T, Ito K, Nose T | title = Antiarrhythmic effect of KB-944, a new calcium antagonist. A comparison with verapamil and diltiazem | journal = Arzneimittel-Forschung | volume = 32 | issue = 9 | pages = 1056–9 | year = 1982 | pmid = 6890826 | doi = | url = }}</ref>

==الاسماء التجارية==

*986,A-53
*KB-944

==الاصطناع==

[[Image:Fostedil.png|500px]]<ref name="pmid3701791">{{cite journal | author = Yoshino K, Kohno T, Uno T, Morita T, Tsukamoto G | title = Organic phosphorus compounds. 1. 4-(Benzothiazol-2-yl)benzylphosphonate as potent calcium antagonistic vasodilator | journal = Journal of Medicinal Chemistry | volume = 29 | issue = 5 | pages = 820–5 | year = 1986 | month = May | pmid = 3701791 | doi = 10.1021/jm00155a037| url = }}</ref>

==مصادر==

{{ثبت المراجع}}

{{بذرة}}
{{حاصرات قنوات الكالسيوم}}

[[تصنيف:أدوية]]
[[تصنيف:موسوعة الأدوية]]
[[تصنيف:حاصرات قنوات الكالسيوم]]

فوستيديل - تاريخ المراجعة

أسيل سيوف: أنشأ الصفحة ب'{{Drugbox | IUPAC_name = diethyl [4-(1,3-benzothiazol-2-yl)benzyl]phosphonate | image = Fostedil_structure.png | tradename = | pregnancy_category...'