سلام المجذوب: أنشأ الصفحة ب'{{drugbox | Watchedfields = changed | verifiedrevid = 464389436 | IUPAC_name = (1''S'',4''S'')-4-(3,4-dichlorophenyl)-''N''-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |...'

2015-03-17T11:04:28Z

أنشأ الصفحة ب'{{drugbox | Watchedfields = changed | verifiedrevid = 464389436 | IUPAC_name = (1''S'',4''S'')-4-(3,4-dichlorophenyl)-''N''-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |...'

صفحة جديدة

{{drugbox
| Watchedfields = changed
| verifiedrevid = 464389436
| IUPAC_name = (1''S'',4''S'')-4-(3,4-dichlorophenyl)-''N''-methyl-1,2,3,4-tetrahydronaphthalen-1-amine
| image =
| width = 150
| image2 = Sertraline3Dan3.gif
| width2 = 250


| tradename = Zoloft, Lustral, Daxid, Deprax, Altruline, Besitran, Eleval, Emergen, Gladem, Implicane, Sedoran, Sealdin, Serivo, Lowfin, Stimuloton, Serimel, Seretral, Tresleen, Sertralin Bluefish  
| Drugs.com = {{drugs.com|monograph|zoloft}}
| MedlinePlus = a697048
| pregnancy_category = C
| legal_status = Rx-only
| routes_of_administration = Oral


| bioavailability = 44%
| protein_bound = 98.5%
| metabolism = [[Hepatic]] (N-[[demethylation]] mainly by [[CYP2B6]])<ref name="pmid15547048">{{cite journal | author = Obach RS, Cox LM, Tremaine LM | title = Sertraline is metabolized by multiple cytochrome P450 enzymes, monoamine oxidases, and glucuronyl transferases in human: an in vitro study | journal = Drug Metab. Dispos. | volume = 33 | issue = 2 | pages = 262–70 | year = 2005 | pmid = 15547048 | doi = 10.1124/dmd.104.002428 }}</ref>
| elimination_half-life = Approximately 26 hours
| excretion = Renal


| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 79617-96-2
| ATC_prefix = N06
| ATC_suffix = AB06
| PubChem = 68617
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01104
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 61881
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = QUC7NX6WMB
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D02360
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 9123
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 809


| C=17 | H=17 | Cl=2 | N=1
| molecular_weight = 306.229 g/mol
| smiles = ClC1=CC=C([C@H]2C3=C([C@H](CC2)NC)C=CC=C3)C=C1Cl
| InChI = 1/C17H17Cl2N/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11/h2-6,8,10,12,17,20H,7,9H2,1H3/t12-,17-/m0/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H17Cl2N/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11/h2-6,8,10,12,17,20H,7,9H2,1H3/t12-,17-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VGKDLMBJGBXTGI-SJCJKPOMSA-N
}}

'''زولوفت''' أو '''سيرترالين''' {{إنج|Sertraline}} هو دواء مضاد للاكتئاب ،ينتمي العلاج إلى عائلة "[[مثبطات استرداد السيريتونين الانتقائية]]"، والتي تعمل على زيادة نسبة ال[[سيريتونين]] في [[الجهاز العصبي]] المعروف بتأثيره المحسن للمزاج و المزيل لل[[اكتئاب]].<ref>{{cite web|url = http://psychcentral.com/lib/2012/top-25-psychiatric-medication-prescriptions-for-2011/|title = Top 25 Psychiatric Medication Prescriptions for 2011| accessdate = 2013-01-09|author = John M. Grohol|year = 2012|publisher = Psych Central}}</ref>وهذا الدواء يثبط، بشكل محدد، عودة استغلال السيرتونين في ال[[دماغ]] . وهو مماثل، في فاعليته، لادوية [[فلوكستين]] (Fluoxetine)، [[بارواكسيتين]] (paroxetine) و[[سيتالوبرام]] (Citalopram).<ref>{{cite journal| title = Comparative efficacy and acceptability of 12 new-generation antidepressants: a multiple-treatments meta-analysis|journal = The Lancet| volume = 373| issue = 9665| pages = 746–758| pmid = 19185342| doi = 10.1016/S0140-6736(09)60046-5 |laysummary = http://www.washingtonpost.com/wp-dyn/content/article/2009/01/29/AR2009012901774.html| laysource = The Washington Post| laydate = January 29, 2009| year = 2009| last1 = Cipriani| first1 = Andrea| last2 = Furukawa| first2 = Toshiaki A| last3 = Salanti| first3 = Georgia| last4 = Geddes| first4 = John R| last5 = Higgins| first5 = Julian PT| last6 = Churchill| first6 = Rachel| last7 = Watanabe| first7 = Norio| last8 = Nakagawa| first8 = Atsuo| last9 = Omori| first9 = Ichiro M}}</ref>
كما يستخدم هذا الدواء لمعالجة حالات [[الوسواس القهري]] ، وال[[قلق]] الاجتماعي ونوبات الذعر والمشاكل من بعد الصدمات . وثمة استخدامات اخرى يتم البحث فيها تشمل معالجة الاكتئاب السابق للحيض أو [[اضطراب ما قبل الطمث الاكتئابي]] (Premenstrual dysphoric disorder) ، الاكتئاب الذهاني ، والمشاكل السلوكية نتيجة الإصابة الدماغية والقذف المبكر (Ejaculatio praecox).<ref name="pmid14709946"/><ref name="pmid11343529">CGI-Improvement, mean ± SD: Sertraline = 2.3 ± 0.1 Placebo = 2.8 ± 0.1. CGI-Severity, mean ± SD: Change Sertraline = −1.3 ± 0.1; placebo = −1.0 ± 0.1 {{cite journal |author=Davidson JR, Rothbaum BO, van der Kolk BA, Sikes CR, Farfel GM |title=Multicenter, double-blind comparison of sertraline and placebo in the treatment of posttraumatic stress disorder |journal=Arch. Gen. Psychiatry |volume=58 |issue=5 |pages=485–92 |year=2001 |pmid=11343529|doi=10.1001/archpsyc.58.5.485}}</ref>
==الأستخدامات==
يستخدم عقار السيرترالين في علاج :الاكتئاب <ref name="pmid18199864">{{cite journal |author=Turner EH, Matthews AM, Linardatos E, Tell RA, Rosenthal R |title=Selective publication of antidepressant trials and its influence on apparent efficacy |journal=N. Engl. J. Med. |volume=358 |issue=3 |pages=252–60 |year=2008 |pmid=18199864 |doi=10.1056/NEJMsa065779 |url=}}</ref> ،اضرابات الهلع،الرهاب،اضطراب الكرب التالي للرضخ،الوساس القهري،الاضطراب المزعج السابق للحيض.<ref name=AHFS>{{cite web|title=Sertraline hydrochloride|url=http://www.drugs.com/monograph/sertraline-hydrochloride.html|work=The American Society of Health-System Pharmacists|accessdate=3 April 2011}}</ref>
[[File:Zoloft bottles.jpg|thumb|زولوفت 50 ملغ و 25 ملغ ([[الولايات المتحدة]])]]

==موانع الاستخدام==
يمنع استخدامه السيرترالين للمرضى الذين أظهروا فرط الحساسية للعلاج.<ref name="zoloftpi">{{cite web |url=http://www.zoloft.com |title=Zoloft Prescribing Information for the U.S|format= PDF|publisher=Pfizer |accessdate=2008-04-26}}</ref> يجب ان كما يمنع اعطاءه اذا كان المريض يتناول بنفس الوقت مثبطات أكسيداز أحادي الأمين .<ref name=zoloftpi/> Sertraline appears to be associated with [[microscopic colitis]], a rare condition of unknown [[etiology]].<ref name="pmid17100977">{{cite journal |author=Fernández-Bañares F, Esteve M, Espinós JC, Rosinach M, Forné M, Salas A, Viver JM |title=Drug consumption and the risk of microscopic colitis |journal=Am. J. Gastroenterol. |volume=102 |issue=2 |pages=324–30 |year=2007 |pmid=17100977 |doi=10.1111/j.1572-0241.2006.00902.x}}</ref>وايضا مع مضاد الذهان البيموزايد .<ref name="pmid9018398">{{cite journal |author=Olivera AO |title=Sertraline and akathisia: spontaneous resolution |journal=Biol. Psychiatry |volume=41 |issue=2 |pages=241–2 |year=1997 |pmid=9018398|doi=10.1016/S0006-3223(96)00384-8}}</ref> <ref name="pmid8909330">Review:{{cite journal |doi=10.4088/JCP.v57n1002 |author=Leo RJ |title=Movement disorders associated with the serotonin selective reuptake inhibitors |journal=The Journal of Clinical Psychiatry |volume=57 |issue=10 |pages=449–54 |year=1996 |pmid=8909330}}</ref><ref name="pmid9378692">{{cite journal |doi=10.4088/JCP.v58n0906a |author=Lauterbach EC, Meyer JM, Simpson GM |title=Clinical manifestations of dystonia and dyskinesia after SSRI administration |journal=The Journal of Clinical Psychiatry |volume=58 |issue=9 |pages=403–4 |year=1997 |pmid=9378692}}</ref><ref name="pmid12407283">{{cite journal |author=Walker L |title=Sertraline-induced akathisia and dystonia misinterpreted as a panic attack |journal=Psychiatric Services (Washington, D.C.) |volume=53 |issue=11 |pages=1477–8 |year=2002 |pmid=12407283 |doi=10.1176/appi.ps.53.11.1477}}</ref>

==المراجع==
{{مراجع}}
==وصلات خارجية==
* [http://www.merck.com/mmpe/lexicomp/sertraline.html List of international brand names for sertraline]
* [http://druginfo.nlm.nih.gov/drugportal/dpdirect.jsp?name=Sertraline U.S. National Library of Medicine: Drug Information Portal – Sertraline]

{{شريط بوابات|طب}}
{{تصنيف كومنز|Sertraline}}

[[تصنيف:أمينات]]
[[تصنيف:كلوريدات عضوية]]
[[تصنيف:مثبطات إعادة امتصاص السيروتونين الاختيارية]]

سيرترالين - تاريخ المراجعة

سلام المجذوب: أنشأ الصفحة ب'{{drugbox | Watchedfields = changed | verifiedrevid = 464389436 | IUPAC_name = (1''S'',4''S'')-4-(3,4-dichlorophenyl)-''N''-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |...'