تيوبرونين - تاريخ المراجعة

كنان الطرح في 08:26، 11 يناير 2016

2016-01-11T08:26:52Z

→ مراجعة أقدم		مراجعة 08:26، 11 يناير 2016
سطر 1:		سطر 1:
			{{chembox
			\| Watchedfields = changed
			\| verifiedrevid = 470610633
			\| ImageFile = Tiopronin.svg
			\| ImageFile_Ref = {{chemboximage\|correct\|??}}
			\| ImageName = Skeletal formula of tiopronin
			\| IUPACName = 2-(2-sulfanylpropanoylamino)acetic acid
			\| OtherNames = 2-mercaptopropionylglycine <br /> Acadione <br /> Thiola
			\|Section1={{Chembox Identifiers
			\| CASNo = 1953-02-2
			\| CASNo_Ref = {{cascite\|correct\|CAS}}
			\| CASNo1 = 29335-92-0
			\| CASNo1_Ref = {{cascite\|correct\|??}}
			\| CASNo1_Comment = <small>''R''</small>
			\| PubChem = 5483
			\| PubChem1 = 208825
			\| PubChem1_Comment = <small>''R''</small>
			\| PubChem2 = 736152
			\| PubChem2_Comment = <small>''S''</small>
			\| ChemSpiderID = 5283
			\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
			\| ChemSpiderID1 = 180938
			\| ChemSpiderID1_Ref = {{chemspidercite\|correct\|chemspider}}
			\| ChemSpiderID1_Comment = <small>''R''</small>
			\| ChemSpiderID2 = 643292
			\| ChemSpiderID2_Ref = {{chemspidercite\|correct\|chemspider}}
			\| ChemSpiderID2_Comment = <small>''S''</small>
			\| UNII = C5W04GO61S
			\| UNII_Ref = {{fdacite\|correct\|FDA}}
			\| EINECS = 217-778-4
			\| KEGG = D01430
			\| KEGG_Ref = {{keggcite\|correct\|kegg}}
			\| MeSHName = Tiopronin
			\| ChEMBL = 1314
			\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
			\| RTECS = MC0596500
			\| Beilstein = 1859822
			\| SMILES = CC(S)c(:[o]):[nH]Cc(:[o]):[oH]
			\| SMILES1 = CC(S)C(=O)NCC(O)=O
			\| StdInChI = 1S/C5H9NO3S/c1-3(10)5(9)6-2-4(7)8/h3,10H,2H2,1H3,(H,6,9)(H,7,8)
			\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
			\| StdInChIKey = YTGJWQPHMWSCST-UHFFFAOYSA-N
			\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
			}}
			\|Section2={{Chembox Properties
			\| C=5 \| H=9 \| N=1 \| S=1 \| O=3
			\| Appearance = White, opaque crystals
			\| MeltingPtC = 93 to 98
			\| LogP = −0.674
			\| pKa = 3.356
			\| pKb = 10.641
			}}
			\|Section6={{Chembox Pharmacology
			\| ATCCode_prefix = R05
			\| ATCCode_suffix = CB12
			\| ATC_Supplemental = {{aTCvet\|G04\|BC90}}
			\| Legal_US = Rx
			\| Pregnancy_US = C
			}}
			\|Section7={{Chembox Hazards
			\| GHSPictograms = {{gHS exclamation mark}}
			\| GHSSignalWord = '''WARNING'''
			\| HPhrases = {{h-phrases\|302}}
			\| EUClass = {{hazchem Xn}}
			\| RPhrases = {{r22}}
			\| SPhrases = {{s36/37}}
			\| LD50 = 1,300 mg kg<sup>−1</sup> <small>(oral, rat)</small>
			}}
			\|Section8={{Chembox Related
			\| OtherFunction_label = alkanoic acids
			\| OtherFunction = {{unbulleted list\|[[Acetylcysteine]]\|[[Glycylglycine]]\|[[Iminodiacetic acid]]\|[[Nitrilotriacetic acid]]\|[[n-Oxalylglycine\|''N''-Oxalylglycine]]\|[[Bucillamine]]\|[[Oxalyldiaminopropionic acid]]\|[[gamma-Glutamylcysteine\|''gamma''-Glutamylcysteine]]}}
			\| OtherCompounds = {{unbulleted list\|[[n-Acetylglycinamide\|''N''-Acetylglycinamide]]}}
			}}
			}}


	==الاستخدام==		==الاستخدام==
	يستخدم للسيطرة على إفراز السيستئين في مرض بيلة السيستيئين disease cystinuria		يستخدم للسيطرة على إفراز السيستئين في مرض بيلة السيستيئين disease cystinuria

كنان الطرح في 08:25، 11 يناير 2016

2016-01-11T08:25:42Z

@@ سطر 1: / سطر 1: @@
-{{chembox
+==الاستخدام==
-| Watchedfields = changed
+يستخدم للسيطرة على إفراز السيستئين في مرض بيلة السيستيئين   disease cystinuria
 ==المصادر==

كنان الطرح: أنشأ الصفحة ب'{{chembox | Watchedfields = changed | verifiedrevid = 470610633 | ImageFile = Tiopronin.svg | ImageFile_Ref = {{chemboximage|correct|??}} | ImageName = Skeletal formula...'

2016-01-11T08:17:46Z

أنشأ الصفحة ب'{{chembox | Watchedfields = changed | verifiedrevid = 470610633 | ImageFile = Tiopronin.svg | ImageFile_Ref = {{chemboximage|correct|??}} | ImageName = Skeletal formula...'

صفحة جديدة

{{chembox
| Watchedfields = changed
| verifiedrevid = 470610633
| ImageFile = Tiopronin.svg
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageName = Skeletal formula of tiopronin
| IUPACName = 2-(2-sulfanylpropanoylamino)acetic acid
| OtherNames = 2-mercaptopropionylglycine Acadione Thiola
|Section1={{Chembox Identifiers
| CASNo = 1953-02-2
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 29335-92-0
| CASNo1_Ref = {{cascite|correct|??}}
| CASNo1_Comment = ''R''
| PubChem = 5483
| PubChem1 = 208825
| PubChem1_Comment = ''R''
| PubChem2 = 736152
| PubChem2_Comment = ''S''
| ChemSpiderID = 5283
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID1 = 180938
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID1_Comment = ''R''
| ChemSpiderID2 = 643292
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID2_Comment = ''S''
| UNII = C5W04GO61S
| UNII_Ref = {{fdacite|correct|FDA}}
| EINECS = 217-778-4
| KEGG = D01430
| KEGG_Ref = {{keggcite|correct|kegg}}
| MeSHName = Tiopronin
| ChEMBL = 1314
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| RTECS = MC0596500
| Beilstein = 1859822
| SMILES = CC(S)c(:[o]):[nH]Cc(:[o]):[oH]
| SMILES1 = CC(S)C(=O)NCC(O)=O
| StdInChI = 1S/C5H9NO3S/c1-3(10)5(9)6-2-4(7)8/h3,10H,2H2,1H3,(H,6,9)(H,7,8)
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YTGJWQPHMWSCST-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
}}
|Section2={{Chembox Properties
| C=5 | H=9 | N=1 | S=1 | O=3
| Appearance = White, opaque crystals
| MeltingPtC = 93 to 98
| LogP = −0.674
| pKa = 3.356
| pKb = 10.641
}}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = R05
| ATCCode_suffix = CB12
| ATC_Supplemental = {{aTCvet|G04|BC90}}
| Legal_US = Rx
| Pregnancy_US = C
}}
|Section7={{Chembox Hazards
| GHSPictograms = {{gHS exclamation mark}}
| GHSSignalWord = '''WARNING'''
| HPhrases = {{h-phrases|302}}
| EUClass = {{hazchem Xn}}
| RPhrases = {{r22}}
| SPhrases = {{s36/37}}
| LD50 = 1,300 mg kg−1 (oral, rat)
}}

==المصادر==
https://en.wikipedia.org/wiki/Tiopronin

{{مستحضرات السعال والرشح}}
[[تصنيف:أدوية]]
[[تصنيف:موسوعة الأدوية]]
[[تصنيف:أدوية السعال والرشح]]