https://www.arabsciencepedia.org/w/index.php?action=history&feed=atom&title=%D8%A8%D9%8A%D9%81%D9%88%D9%83%D8%B3%D9%8A%D9%84_%D9%81%D8%A7%D9%84%D8%A8%D8%B1%D9%88%D8%A7%D8%AA
بيفوكسيل فالبروات - تاريخ المراجعة
2026-04-22T13:19:26Z
تاريخ التعديل لهذه الصفحة في الويكي
MediaWiki 1.43.6
https://www.arabsciencepedia.org/w/index.php?title=%D8%A8%D9%8A%D9%81%D9%88%D9%83%D8%B3%D9%8A%D9%84_%D9%81%D8%A7%D9%84%D8%A8%D8%B1%D9%88%D8%A7%D8%AA&diff=39393&oldid=prev
أسيل سيوف: أنشأ الصفحة ب'{{Drugbox | Verifiedfields = changed | verifiedrevid = 477003027 | IUPAC_name = [(2,2-dimethylpropanoyl)oxy]methyl 2-propylpentanoate | image = Valproate_pivoxil.png <!...'
2017-11-16T09:30:16Z
<p>أنشأ الصفحة ب'{{Drugbox | Verifiedfields = changed | verifiedrevid = 477003027 | IUPAC_name = [(2,2-dimethylpropanoyl)oxy]methyl 2-propylpentanoate | image = Valproate_pivoxil.png <!...'</p>
<p><b>صفحة جديدة</b></p><div>{{Drugbox<br />
| Verifiedfields = changed<br />
| verifiedrevid = 477003027<br />
| IUPAC_name = [(2,2-dimethylpropanoyl)oxy]methyl 2-propylpentanoate<br />
| image = Valproate_pivoxil.png<br />
<br />
<!--Clinical data--><br />
| tradename = <br />
| pregnancy_category = <br />
| legal_status = Rx-only<br />
| routes_of_administration = [[Mouth|Oral]]<br />
<br />
<!--Pharmacokinetic data--><br />
| bioavailability = <br />
| metabolism = <br />
| elimination_half-life = <br />
| excretion =<br />
<br />
<!--Identifiers--><br />
| CAS_number_Ref = {{cascite|changed|??}}<br />
| CAS_number = 77372-61-3<br />
| ATC_prefix = none<br />
| ATC_suffix = <br />
| PubChem = 71160<br />
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}<br />
| ChemSpiderID = 64301<br />
| UNII_Ref = {{fdacite|changed|FDA}}<br />
| UNII = 9F5A05A29T<br />
<br />
<!--Chemical data--><br />
| C=14 | H=26 | O=4 <br />
| molecular_weight = 258.35 g/mol<br />
| smiles = O=C(OCOC(=O)C(C)(C)C)C(CCC)CCC<br />
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}<br />
| StdInChI = 1S/C14H26O4/c1-6-8-11(9-7-2)12(15)17-10-18-13(16)14(3,4)5/h11H,6-10H2,1-5H3<br />
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}<br />
| StdInChIKey = DJEFRLDEQKSNLM-UHFFFAOYSA-N<br />
}}<br />
<br />
'''بيفوكسيل فالبروات Valproate pivoxil '''<br />
(Pivadin, Valproxen)<br />
هو [[مضاد اختلاج]] يستخدم في علاج ال[[صرع]].<ref name="isbn0-412-46630-9">{{cite book | author = David J. Triggle | title = Dictionary of pharmacological agents | publisher = Chapman & Hall | location = London | year = 1997 | pages = | isbn = 0-412-46630-9 | oclc = | doi = | url = https://books.google.com/books?id=A0THacd46ZsC&lpg=PA1685&dq=%22valproate%20pivoxil%22&pg=PA1685#v=onepage&q&f=false}}</ref> <br />
وهو المشتق البيفالويلوكسي ميتيل الاستري لل[[فالبرويك أسيد]].<br />
من المرجح أنه طليعة دواء لحمض الفالبرويك،<ref name="isbn0-7514-0499-3">{{cite book | author1 = Hall, Judith A. |author2 = Morton, Ian | title = Concise dictionary of pharmacological agents: properties and synonyms | publisher = Kluwer Academic | location = | year = 1999 | pages = 342 | isbn = 0-7514-0499-3 | oclc = | doi = | url = https://books.google.com/books?id=mqaOMOtk61IC&lpg=PA287&ots=T6tnWnGoXw&dq=%22valproate%20pivoxil%22&pg=PA287#v=onepage&q=%22valproate%20pivoxil%22&f=false}}</ref> يوظف مثل الاسترات البيفالوكسيلية بشكل شائع كطليعة دواء في الكيمياء الطبية.<br />
==مصادر==<br />
{{ثبت المراجع}}<br />
<br />
{{مضادات الاختلاج}}<br />
<br />
{{Mood stabilizers}}<br />
{{GABA metabolism and transport modulators}}<br />
{{HDAC inhibitors}}<br />
{{Ion channel modulators}}<br />
<br />
[[تصنيف:أدوية]]<br />
[[تصنيف:موسوعة الأدوية]]<br />
[[تصنيف:مضادات الاختلاج]]</div>
أسيل سيوف