https://www.arabsciencepedia.org/w/index.php?action=history&feed=atom&title=%D8%A8%D9%88%D8%B3%D9%8A%D9%84%D8%A7%D9%85%D9%8A%D9%86 بوسيلامين - تاريخ المراجعة 2026-04-16T01:13:46Z تاريخ التعديل لهذه الصفحة في الويكي MediaWiki 1.43.6 https://www.arabsciencepedia.org/w/index.php?title=%D8%A8%D9%88%D8%B3%D9%8A%D9%84%D8%A7%D9%85%D9%8A%D9%86&diff=35762&oldid=prev كنان الطرح: أنشأ الصفحة ب'{{chembox | English = Bucillamine | ImageFile = bucillamine.png | ImageFile_Ref = {{chemboximage|correct|??}} | ImageSize = 160 | ImageName = Skeletal formula of bucilla...' 2014-02-18T16:55:28Z <p>أنشأ الصفحة ب&#039;{{chembox | English = Bucillamine | ImageFile = bucillamine.png | ImageFile_Ref = {{chemboximage|correct|??}} | ImageSize = 160 | ImageName = Skeletal formula of bucilla...&#039;</p> <p><b>صفحة جديدة</b></p><div>{{chembox<br /> | English = Bucillamine<br /> | ImageFile = bucillamine.png<br /> | ImageFile_Ref = {{chemboximage|correct|??}}<br /> | ImageSize = 160<br /> | ImageName = Skeletal formula of bucillamine<br /> | IUPACName = 2-[(2-Methyl-2-sulfanylpropanoyl)amino]-3-sulfanylpropanoic acid{{citation needed|date=June 2012}}<br /> | Section1 = {{chembox Identifiers<br /> | CASNo = 65002-17-7<br /> | CASNo_Ref = {{cascite|correct|??}}<br /> | CASNo_Comment = &lt;small&gt;&#039;&#039;R&#039;&#039;&lt;/small&gt;<br /> | PubChem = 2459<br /> | PubChem_Ref = {{pubchemcite|correct|pubchem}}<br /> | PubChem1 = 656604<br /> | PubChem1_Ref = {{pubchemcite|correct|pubchem}}<br /> | PubChem1_Comment = &lt;small&gt;&#039;&#039;R&#039;&#039;&lt;/small&gt;<br /> | PubChem2 = 636373<br /> | PubChem2_Ref = {{pubchemcite|correct|pubchem}}<br /> | PubChem2_Comment = &lt;small&gt;&#039;&#039;S&#039;&#039;&lt;/small&gt;<br /> | ChemSpiderID = 2365<br /> | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}<br /> | UNII = R80LRA5WTF<br /> | UNII_Ref = {{fdacite|correct|FDA}}<br /> | KEGG = D01809<br /> | KEGG_Ref = {{keggcite|correct|kegg}}<br /> | MeSHName = bucillamine<br /> | ChEMBL = 80830<br /> | ChEMBL_Ref = {{ebicite|correct|EBI}}<br /> | ATCCode_prefix = M01<br /> | ATCCode_suffix = CC02<br /> | SMILES = CC(C)(S)c(:[o]):[nH]C(CS)c(:[o]):[oH]<br /> | SMILES1 = CC(C)(S)C(=O)NC(CS)C(O)=O<br /> | StdInChI = 1S/C7H13NO3S2/c1-7(2,13)6(11)8-4(3-12)5(9)10/h4,12-13H,3H2,1-2H3,(H,8,11)(H,9,10)<br /> | StdInChI_Ref = {{stdinchicite|correct|chemspider}}<br /> | StdInChIKey = VUAFHZCUKUDDBC-UHFFFAOYSA-N<br /> | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}<br /> }}<br /> | Section2 = {{chembox Properties<br /> | C = 7<br /> | H = 13<br /> | N = 1<br /> | O = 3<br /> | S = 2<br /> | LogP = 1.032<br /> | pKa = 3.012<br /> | pKb = 10.985<br /> }}<br /> | Section3 = {{chembox Related<br /> | Function = alkanoic acids<br /> | OtherFunctn = {{unbulleted list|[[Acetylcysteine]]|[[Glycylglycine]]|[[Iminodiacetic acid]]|[[Nitrilotriacetic acid]]|[[n-Oxalylglycine|&#039;&#039;N&#039;&#039;-Oxalylglycine]]|[[Tiopronin]]|[[Oxalyldiaminopropionic acid]]|[[gamma-Glutamylcysteine|&#039;&#039;gamma&#039;&#039;-Glutamylcysteine]]}}<br /> | OtherCpds = {{unbulleted list|[[n-Acetylglycinamide|&#039;&#039;N&#039;&#039;-Acetylglycinamide]]}}<br /> }}<br /> }}<br /> &#039;&#039;&#039; بوسيلامين (Bucillamine)&#039;&#039;&#039;<br /> دواء فموي يستخدم [[مضادات الروماتيزم|كمضاد للروماتيزم]].<br /> <br /> {{بذرة}} <br /> {{مضادات الروماتيزم}}<br /> [[تصنيف:أدوية]]<br /> [[تصنيف:موسوعة الأدوية]]<br /> [[تصنيف:مضادات الروماتيزم]]</div> كنان الطرح