https://www.arabsciencepedia.org/w/index.php?action=history&feed=atom&title=%D8%A3%D8%B3%D9%8A%D8%AA%D8%A7%D8%B1%D8%B3%D9%88%D9%84
أسيتارسول - تاريخ المراجعة
2026-05-23T05:19:54Z
تاريخ التعديل لهذه الصفحة في الويكي
MediaWiki 1.43.6
https://www.arabsciencepedia.org/w/index.php?title=%D8%A3%D8%B3%D9%8A%D8%AA%D8%A7%D8%B1%D8%B3%D9%88%D9%84&diff=36052&oldid=prev
ندى المؤذن: أنشأ الصفحة ب'{{Chembox | Verifiedfields = changed | verifiedrevid = 477238724 | ImageFile = Acetarsol.svg | ImageFile_Ref = {{chemboximage|correct|??}} | ImageSize = 244 | ImageName ...'
2014-07-30T23:36:24Z
<p>أنشأ الصفحة ب'{{Chembox | Verifiedfields = changed | verifiedrevid = 477238724 | ImageFile = Acetarsol.svg | ImageFile_Ref = {{chemboximage|correct|??}} | ImageSize = 244 | ImageName ...'</p>
<p><b>صفحة جديدة</b></p><div>{{Chembox<br />
| Verifiedfields = changed<br />
| verifiedrevid = 477238724<br />
| ImageFile = Acetarsol.svg<br />
| ImageFile_Ref = {{chemboximage|correct|??}}<br />
| ImageSize = 244<br />
| ImageName = Kekulé, skeletal formula of acetarsol<br />
| PIN = Acetarsone{{Citation needed|date = June 2011}}<br />
| SystematicName = (3-Acetamido-4-hydroxyphenyl)arsonic acid<ref>{{Cite web|url = http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1985|title = acetarsol - PubChem Public Chemical Database|work = The PubChem Project|location = USA|publisher = National Center for Biotechnology Information}}</ref><br />
| OtherNames = 3-Acetamido-4-hydroxyphenylarsonic acid{{Citation needed|date = June 2011}}<br />
| Section1 = {{Chembox Identifiers<br />
| CASNo_Ref = {{cascite|changed|??}}<br />
| CASNo = 97-44-9<br />
| ChEMBL_Ref = {{ebicite|changed|EBI}}<br />
| ChEMBL = 1330792<br />
| PubChem = 1985<br />
| PubChem_Ref = {{Pubchemcite|correct|pubchem}}<br />
| ChemSpiderID = 1908<br />
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}<br />
| UNII = 806529YU1N<br />
| UNII_Ref = {{fdacite|correct|FDA}}<br />
| EINECS = 202-582-3<br />
| UNNumber = 3465<br />
| KEGG_Ref = {{keggcite|correct|kegg}}<br />
| KEGG = D07110<br />
| MeSHName = Acetarsol<br />
| ATCCode_prefix = A07<br />
| ATCCode_suffix = AX02<br />
| ATC_Supplemental = {{ATC|G01|AB01}}, {{ATC|P01|CD02}}, {{ATC|P51|AD05}}<br />
| SMILES = CC(=O)Nc1cc(ccc1O)[As](O)(O)=O<br />
| SMILES1 = CC(=O)NC1=CC(=CC=C1O)[As](O)(O)=O<br />
| StdInChI = 1S/C8H10AsNO5/c1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12/h2-4,12H,1H3,(H,10,11)(H2,13,14,15)<br />
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}<br />
| InChI = 1/C8H10AsNO5/c1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12/h2-4,12H,1H3,(H,10,11)(H2,13,14,15)<br />
| StdInChIKey = ODFJOVXVLFUVNQ-UHFFFAOYSA-N<br />
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}<br />
| InChIKey = ODFJOVXVLFUVNQ-UHFFFAOYAX}}<br />
| Section2 = {{Chembox Properties<br />
| Formula = {{Chem|C|8|AsNH|10|O|5}}<br />
| MolarMass = 275.0903 g mol<sup>-1</sup><br />
| ExactMass = 274.977493852 g mol<sup>-1</sup><br />
}}<br />
| Section3 = {{Chembox Hazards<br />
| GHSPictograms = {{GHS skull and crossbones}} {{GHS environment}}<br />
| GHSSignalWord = Danger<br />
| HPhrases = {{H-phrases|301|331|410}}<br />
| PPhrases = {{P-phrases|261|273|301+310|311|501}}<br />
| EUClass = {{Hazchem T}} {{Hazchem N}}<br />
| RPhrases = {{R23/25}}, {{R50/53}}<br />
| SPhrases = {{S20/21}}, {{S28}}, {{S45}}, {{S60}}, {{S61}}<br />
}}<br />
}}<br />
'''{{Chembox<br />
| Verifiedfields = changed<br />
| verifiedrevid = 477238724<br />
| ImageFile = Acetarsol.svg<br />
| ImageFile_Ref = {{chemboximage|correct|??}}<br />
| ImageSize = 244<br />
| ImageName = Kekulé, skeletal formula of acetarsol<br />
| PIN = Acetarsone{{Citation needed|date = June 2011}}<br />
| SystematicName = (3-Acetamido-4-hydroxyphenyl)arsonic acid<ref>{{Cite web|url = http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1985|title = acetarsol - PubChem Public Chemical Database|work = The PubChem Project|location = USA|publisher = National Center for Biotechnology Information}}</ref><br />
| OtherNames = 3-Acetamido-4-hydroxyphenylarsonic acid{{Citation needed|date = June 2011}}<br />
| Section1 = {{Chembox Identifiers<br />
| CASNo_Ref = {{cascite|changed|??}}<br />
| CASNo = 97-44-9<br />
| ChEMBL_Ref = {{ebicite|changed|EBI}}<br />
| ChEMBL = 1330792<br />
| PubChem = 1985<br />
| PubChem_Ref = {{Pubchemcite|correct|pubchem}}<br />
| ChemSpiderID = 1908<br />
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}<br />
| UNII = 806529YU1N<br />
| UNII_Ref = {{fdacite|correct|FDA}}<br />
| EINECS = 202-582-3<br />
| UNNumber = 3465<br />
| KEGG_Ref = {{keggcite|correct|kegg}}<br />
| KEGG = D07110<br />
| MeSHName = Acetarsol<br />
| ATCCode_prefix = A07<br />
| ATCCode_suffix = AX02<br />
| ATC_Supplemental = {{ATC|G01|AB01}}, {{ATC|P01|CD02}}, {{ATC|P51|AD05}}<br />
| SMILES = CC(=O)Nc1cc(ccc1O)[As](O)(O)=O<br />
| SMILES1 = CC(=O)NC1=CC(=CC=C1O)[As](O)(O)=O<br />
| StdInChI = 1S/C8H10AsNO5/c1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12/h2-4,12H,1H3,(H,10,11)(H2,13,14,15)<br />
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}<br />
| InChI = 1/C8H10AsNO5/c1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12/h2-4,12H,1H3,(H,10,11)(H2,13,14,15)<br />
| StdInChIKey = ODFJOVXVLFUVNQ-UHFFFAOYSA-N<br />
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}<br />
| InChIKey = ODFJOVXVLFUVNQ-UHFFFAOYAX}}<br />
| Section2 = {{Chembox Properties<br />
| Formula = {{Chem|C|8|AsNH|10|O|5}}<br />
| MolarMass = 275.0903 g mol<sup>-1</sup><br />
| ExactMass = 274.977493852 g mol<sup>-1</sup><br />
}}<br />
| Section3 = {{Chembox Hazards<br />
| GHSPictograms = {{GHS skull and crossbones}} {{GHS environment}}<br />
| GHSSignalWord = Danger<br />
| HPhrases = {{H-phrases|301|331|410}}<br />
| PPhrases = {{P-phrases|261|273|301+310|311|501}}<br />
| EUClass = {{Hazchem T}} {{Hazchem N}}<br />
| RPhrases = {{R23/25}}, {{R50/53}}<br />
| SPhrases = {{S20/21}}, {{S28}}, {{S45}}, {{S60}}, {{S61}}<br />
}}<br />
}}<br />
'''Acetarsol'''<br />
*أسيتارسول هو مضاد للعدوى.<br />
*وقد اكتشف لأول مرة في عام 1921 في معهد باستور من قبل Ernest Fourneau, وتباع تحت اسم العلامة التجارية Stovarsol.<br />
*وقد أعطيت في التحاميل.<br />
<br />
==المصدر==<br />
http://en.wikipedia.org/wiki/Acetarsol<br />
<br />
{{العوامل المضادة للإسهال والمضادة للالتهاب المعوي والمضادة للعدوى}}<br />
[[تصنيف:أدوية]]<br />
[[تصنيف:موسوعة الأدوية]]<br />
[[تصنيف:مضادات الإسهال]]<br />
[[تصنيف:مضادات الالتهاب المعوي]]<br />
[[تصنيف:مضادات العدوى]]<br />
{{ثبت المراجع}}</div>
ندى المؤذن